C20H26N4O2 — CID 97416019
(3aR,4R,6aS)-N-(4-ethylphenyl)-1',2'-dimethyl-5'-oxospiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-imidazole]-2-carboxamide (PubChem CID 97416019) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (3aR,4R,6aS)-N-(4-ethylphenyl)-1',2'-dimethyl-5'-oxospiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-imidazole]-2-carboxamide.
| Compound Name | (3aR,4R,6aS)-N-(4-ethylphenyl)-1',2'-dimethyl-5'-oxospiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-imidazole]-2-carboxamide |
|---|---|
| PubChem CID | 97416019 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (3aR,4R,6aS)-N-(4-ethylphenyl)-1',2'-dimethyl-5'-oxospiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-imidazole]-2-carboxamide |
| SMILES | CCc1ccc(NC(=O)N2C[C@H]3CC[C@@]4(N=C(C)N(C)C4=O)[C@H]3C2)cc1 |
| InChI | InChI=1S/C20H26N4O2/c1-4-14-5-7-16(8-6-14)21-19(26)24-11-15-9-10-20(17(15)12-24)18(25)23(3)13(2)22-20/h5-8,15,17H,4,9-12H2,1-3H3,(H,21,26)/t15-,17+,20-/m1/s1 |
| InChIKey | NQJZACPQTJKQEG-OXFYSEKESA-N |
| XLogP | 2.75 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |