C22H23N5O2S — CID 97416492
8-[(3R)-3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]sulfonylquinoline (PubChem CID 97416492) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is 8-[(3R)-3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]sulfonylquinoline.
| Compound Name | 8-[(3R)-3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]sulfonylquinoline |
|---|---|
| PubChem CID | 97416492 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 8-[(3R)-3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]sulfonylquinoline |
| SMILES | CCCc1nc2cccnc2n1[C@@H]1CCN(S(=O)(=O)c2cccc3cccnc23)C1 |
| InChI | InChI=1S/C22H23N5O2S/c1-2-6-20-25-18-9-5-13-24-22(18)27(20)17-11-14-26(15-17)30(28,29)19-10-3-7-16-8-4-12-23-21(16)19/h3-5,7-10,12-13,17H,2,6,11,14-15H2,1H3/t17-/m1/s1 |
| InChIKey | UUIDFKXTVMDWGS-QGZVFWFLSA-N |
| XLogP | 3.57 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |