C19H26FNO4 — CID 97418153
1-[(3S)-3-(ethoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-2-(4-fluorophenoxy)ethanone (PubChem CID 97418153) has the molecular formula C19H26FNO4 and a molecular weight of 351.42 g/mol. Its IUPAC name is 1-[(3S)-3-(ethoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-2-(4-fluorophenoxy)ethanone.
| Compound Name | 1-[(3S)-3-(ethoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-2-(4-fluorophenoxy)ethanone |
|---|---|
| PubChem CID | 97418153 |
| Molecular Formula | C19H26FNO4 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-[(3S)-3-(ethoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-2-(4-fluorophenoxy)ethanone |
| SMILES | CCOC[C@@H]1CC2(CCN(C(=O)COc3ccc(F)cc3)CC2)CO1 |
| InChI | InChI=1S/C19H26FNO4/c1-2-23-12-17-11-19(14-25-17)7-9-21(10-8-19)18(22)13-24-16-5-3-15(20)4-6-16/h3-6,17H,2,7-14H2,1H3/t17-/m0/s1 |
| InChIKey | DUTNZYVXQOEASN-KRWDZBQOSA-N |
| XLogP | 2.64 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |