C17H24FN3O2 — CID 97418198
(3S)-3-(cyclopropylmethoxymethyl)-8-(5-fluoropyrimidin-2-yl)-2-oxa-8-azaspiro[4.5]decane (PubChem CID 97418198) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is (3S)-3-(cyclopropylmethoxymethyl)-8-(5-fluoropyrimidin-2-yl)-2-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3S)-3-(cyclopropylmethoxymethyl)-8-(5-fluoropyrimidin-2-yl)-2-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97418198 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (3S)-3-(cyclopropylmethoxymethyl)-8-(5-fluoropyrimidin-2-yl)-2-oxa-8-azaspiro[4.5]decane |
| SMILES | Fc1cnc(N2CCC3(CC2)CO[C@H](COCC2CC2)C3)nc1 |
| InChI | InChI=1S/C17H24FN3O2/c18-14-8-19-16(20-9-14)21-5-3-17(4-6-21)7-15(23-12-17)11-22-10-13-1-2-13/h8-9,13,15H,1-7,10-12H2/t15-/m0/s1 |
| InChIKey | SODDSURAGYIFKT-HNNXBMFYSA-N |
| XLogP | 2.42 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |