C18H20N2O3S — CID 97419194
[(3S)-3-pyridin-2-yloxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-thiophen-3-ylmethanone (PubChem CID 97419194) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is [(3S)-3-pyridin-2-yloxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-thiophen-3-ylmethanone.
| Compound Name | [(3S)-3-pyridin-2-yloxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 97419194 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [(3S)-3-pyridin-2-yloxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCC2(CC1)C[C@H](Oc1ccccn1)CO2 |
| InChI | InChI=1S/C18H20N2O3S/c21-17(14-4-10-24-13-14)20-8-5-18(6-9-20)11-15(12-22-18)23-16-3-1-2-7-19-16/h1-4,7,10,13,15H,5-6,8-9,11-12H2/t15-/m0/s1 |
| InChIKey | RRCPNWCCKONTEZ-HNNXBMFYSA-N |
| XLogP | 2.99 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |