C17H21ClN2O3 — CID 97419306
(5aR,9aR)-8-[3-(2-chlorophenyl)propanoyl]-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one (PubChem CID 97419306) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is (5aR,9aR)-8-[3-(2-chlorophenyl)propanoyl]-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one.
| Compound Name | (5aR,9aR)-8-[3-(2-chlorophenyl)propanoyl]-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 97419306 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (5aR,9aR)-8-[3-(2-chlorophenyl)propanoyl]-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one |
| SMILES | O=C1NCCO[C@H]2CN(C(=O)CCc3ccccc3Cl)CC[C@@H]12 |
| InChI | InChI=1S/C17H21ClN2O3/c18-14-4-2-1-3-12(14)5-6-16(21)20-9-7-13-15(11-20)23-10-8-19-17(13)22/h1-4,13,15H,5-11H2,(H,19,22)/t13-,15+/m1/s1 |
| InChIKey | FRDRDNVBKPRUFH-HIFRSBDPSA-N |
| XLogP | 1.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |