C18H20N2O3S — CID 97419309
(5aR,9aR)-8-[2-(1-benzothiophen-3-yl)acetyl]-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one (PubChem CID 97419309) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is (5aR,9aR)-8-[2-(1-benzothiophen-3-yl)acetyl]-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one.
| Compound Name | (5aR,9aR)-8-[2-(1-benzothiophen-3-yl)acetyl]-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 97419309 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (5aR,9aR)-8-[2-(1-benzothiophen-3-yl)acetyl]-2,3,4,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-5-one |
| SMILES | O=C1NCCO[C@H]2CN(C(=O)Cc3csc4ccccc34)CC[C@@H]12 |
| InChI | InChI=1S/C18H20N2O3S/c21-17(9-12-11-24-16-4-2-1-3-13(12)16)20-7-5-14-15(10-20)23-8-6-19-18(14)22/h1-4,11,14-15H,5-10H2,(H,19,22)/t14-,15+/m1/s1 |
| InChIKey | CRMGVVATKUVEMM-CABCVRRESA-N |
| XLogP | 1.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |