C19H23N3O3 — CID 97419348
(5aR,9aR)-8-[(5-methyl-1,2-oxazol-3-yl)methyl]-4-phenyl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one (PubChem CID 97419348) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (5aR,9aR)-8-[(5-methyl-1,2-oxazol-3-yl)methyl]-4-phenyl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one.
| Compound Name | (5aR,9aR)-8-[(5-methyl-1,2-oxazol-3-yl)methyl]-4-phenyl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 97419348 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (5aR,9aR)-8-[(5-methyl-1,2-oxazol-3-yl)methyl]-4-phenyl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one |
| SMILES | Cc1cc(CN2CC[C@H]3C(=O)N(c4ccccc4)CCO[C@H]3C2)no1 |
| InChI | InChI=1S/C19H23N3O3/c1-14-11-15(20-25-14)12-21-8-7-17-18(13-21)24-10-9-22(19(17)23)16-5-3-2-4-6-16/h2-6,11,17-18H,7-10,12-13H2,1H3/t17-,18+/m1/s1 |
| InChIKey | JVYDMLJFSBRXSX-MSOLQXFVSA-N |
| XLogP | 2.24 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |