C20H28N2O3 — CID 97419351
(5aR,9aR)-8-(oxan-4-ylmethyl)-4-phenyl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one (PubChem CID 97419351) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is (5aR,9aR)-8-(oxan-4-ylmethyl)-4-phenyl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one.
| Compound Name | (5aR,9aR)-8-(oxan-4-ylmethyl)-4-phenyl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 97419351 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (5aR,9aR)-8-(oxan-4-ylmethyl)-4-phenyl-3,5a,6,7,9,9a-hexahydro-2H-pyrido[4,3-f][1,4]oxazepin-5-one |
| SMILES | O=C1[C@@H]2CCN(CC3CCOCC3)C[C@@H]2OCCN1c1ccccc1 |
| InChI | InChI=1S/C20H28N2O3/c23-20-18-6-9-21(14-16-7-11-24-12-8-16)15-19(18)25-13-10-22(20)17-4-2-1-3-5-17/h1-5,16,18-19H,6-15H2/t18-,19+/m1/s1 |
| InChIKey | LIFVGWJFIOBAPI-MOPGFXCFSA-N |
| XLogP | 2.17 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |