About N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide
N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide (PubChem CID 97420148) has the molecular formula C17H30N2O4S
and a molecular weight of 358.50 g/mol. Its IUPAC name is N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide.
Molecular Properties
| Compound Name | N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide |
| PubChem CID | 97420148 |
| Molecular Formula | C17H30N2O4S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCO[C@]2(CCN(CC3CCOCC3)C2)C1)C1CC1 |
| InChI | InChI=1S/C17H30N2O4S/c20-24(21,16-1-2-16)18-15-5-10-23-17(11-15)6-7-19(13-17)12-14-3-8-22-9-4-14/h14-16,18H,1-13H2/t15-,17-/m1/s1 |
| InChIKey | YVBOFTZGPKYLRU-NVXWUHKLSA-N |
| XLogP | 1.12 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide?
The IUPAC name of N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide (CID 97420148) is N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide.
What is the SMILES notation for N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide?
The canonical SMILES for N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide is O=S(=O)(N[C@@H]1CCO[C@]2(CCN(CC3CCOCC3)C2)C1)C1CC1.
What is the InChIKey of N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide?
The InChIKey is YVBOFTZGPKYLRU-NVXWUHKLSA-N. The full InChI is InChI=1S/C17H30N2O4S/c20-24(21,16-1-2-16)18-15-5-10-23-17(11-15)6-7-19(13-17)12-14-3-8-22-9-4-14/h14-16,18H,1-13H2/t15-,17-/m1/s1.
What are the key properties of N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide?
N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide has a molecular weight of 358.50 g/mol, XLogP of 1.12, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5R,9R)-2-(oxan-4-ylmethyl)-6-oxa-2-azaspiro[4.5]decan-9-yl]cyclopropanesulfonamide is sourced from PubChem (CID 97420148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).