C13H21N3OS — CID 97420163
(5aS,8aS)-4-methyl-7-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine (PubChem CID 97420163) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is (5aS,8aS)-4-methyl-7-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine.
| Compound Name | (5aS,8aS)-4-methyl-7-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine |
|---|---|
| PubChem CID | 97420163 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | (5aS,8aS)-4-methyl-7-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine |
| SMILES | Cc1csc(CN2C[C@@H]3CN(C)CCO[C@@H]3C2)n1 |
| InChI | InChI=1S/C13H21N3OS/c1-10-9-18-13(14-10)8-16-6-11-5-15(2)3-4-17-12(11)7-16/h9,11-12H,3-8H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | QAOPLPAICRUOTA-NWDGAFQWSA-N |
| XLogP | 1.21 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |