C12H17FN4O3S — CID 97420239
(5aR,8aS)-7-(5-fluoropyrimidin-2-yl)-4-methylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine (PubChem CID 97420239) has the molecular formula C12H17FN4O3S and a molecular weight of 316.36 g/mol. Its IUPAC name is (5aR,8aS)-7-(5-fluoropyrimidin-2-yl)-4-methylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine.
| Compound Name | (5aR,8aS)-7-(5-fluoropyrimidin-2-yl)-4-methylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine |
|---|---|
| PubChem CID | 97420239 |
| Molecular Formula | C12H17FN4O3S |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (5aR,8aS)-7-(5-fluoropyrimidin-2-yl)-4-methylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine |
| SMILES | CS(=O)(=O)N1CCO[C@@H]2CN(c3ncc(F)cn3)C[C@@H]2C1 |
| InChI | InChI=1S/C12H17FN4O3S/c1-21(18,19)17-2-3-20-11-8-16(6-9(11)7-17)12-14-4-10(13)5-15-12/h4-5,9,11H,2-3,6-8H2,1H3/t9-,11-/m1/s1 |
| InChIKey | JMRVFOBMYRWGLW-MWLCHTKSSA-N |
| XLogP | -0.29 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |