C13H20N4O4S — CID 97420268
[(5aR,8aS)-4-methylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(2-methylpyrazol-3-yl)methanone (PubChem CID 97420268) has the molecular formula C13H20N4O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is [(5aR,8aS)-4-methylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(2-methylpyrazol-3-yl)methanone.
| Compound Name | [(5aR,8aS)-4-methylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(2-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 97420268 |
| Molecular Formula | C13H20N4O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [(5aR,8aS)-4-methylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(2-methylpyrazol-3-yl)methanone |
| SMILES | Cn1nccc1C(=O)N1C[C@@H]2CN(S(C)(=O)=O)CCO[C@@H]2C1 |
| InChI | InChI=1S/C13H20N4O4S/c1-15-11(3-4-14-15)13(18)16-7-10-8-17(22(2,19)20)5-6-21-12(10)9-16/h3-4,10,12H,5-9H2,1-2H3/t10-,12-/m1/s1 |
| InChIKey | RFIFNSGVHRGFJS-ZYHUDNBSSA-N |
| XLogP | -0.85 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |