C18H25N5O2 — CID 97420293
[(5aR,8aS)-7-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-(1-methylpyrrol-2-yl)methanone (PubChem CID 97420293) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is [(5aR,8aS)-7-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-(1-methylpyrrol-2-yl)methanone.
| Compound Name | [(5aR,8aS)-7-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-(1-methylpyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 97420293 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | [(5aR,8aS)-7-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-(1-methylpyrrol-2-yl)methanone |
| SMILES | Cn1cc(CN2C[C@@H]3CN(C(=O)c4cccn4C)CCO[C@@H]3C2)cn1 |
| InChI | InChI=1S/C18H25N5O2/c1-20-5-3-4-16(20)18(24)23-6-7-25-17-13-22(11-15(17)12-23)10-14-8-19-21(2)9-14/h3-5,8-9,15,17H,6-7,10-13H2,1-2H3/t15-,17-/m1/s1 |
| InChIKey | CQLIPAVTNSVMJO-NVXWUHKLSA-N |
| XLogP | 0.73 |
| TPSA | 55.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |