C17H25N3O2S — CID 97420372
1-[(5aS,8aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-cyclopropylethanone (PubChem CID 97420372) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-[(5aS,8aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-cyclopropylethanone.
| Compound Name | 1-[(5aS,8aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-cyclopropylethanone |
|---|---|
| PubChem CID | 97420372 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-[(5aS,8aS)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-cyclopropylethanone |
| SMILES | Cc1nc(CN2CCO[C@@H]3CN(C(=O)CC4CC4)C[C@@H]3C2)cs1 |
| InChI | InChI=1S/C17H25N3O2S/c1-12-18-15(11-23-12)9-19-4-5-22-16-10-20(8-14(16)7-19)17(21)6-13-2-3-13/h11,13-14,16H,2-10H2,1H3/t14-,16+/m0/s1 |
| InChIKey | DJEJKLMTYDKHLE-GOEBONIOSA-N |
| XLogP | 1.91 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |