C13H19FN4O — CID 97420473
1-[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N,N-dimethylmethanamine (PubChem CID 97420473) has the molecular formula C13H19FN4O and a molecular weight of 266.32 g/mol. Its IUPAC name is 1-[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 97420473 |
| Molecular Formula | C13H19FN4O |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)C[C@]12COC[C@H]1CN(c1ncc(F)cn1)C2 |
| InChI | InChI=1S/C13H19FN4O/c1-17(2)7-13-8-18(5-10(13)6-19-9-13)12-15-3-11(14)4-16-12/h3-4,10H,5-9H2,1-2H3/t10-,13+/m1/s1 |
| InChIKey | NHLCZKVASPLRFJ-MFKMUULPSA-N |
| XLogP | 0.63 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |