C16H21FN4O2 — CID 97420648
N-[[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-2-cyclopropylacetamide (PubChem CID 97420648) has the molecular formula C16H21FN4O2 and a molecular weight of 320.37 g/mol. Its IUPAC name is N-[[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-2-cyclopropylacetamide.
| Compound Name | N-[[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-2-cyclopropylacetamide |
|---|---|
| PubChem CID | 97420648 |
| Molecular Formula | C16H21FN4O2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | N-[[(3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-2-cyclopropylacetamide |
| SMILES | O=C(CC1CC1)NC[C@]12COC[C@H]1CN(c1ncc(F)cn1)C2 |
| InChI | InChI=1S/C16H21FN4O2/c17-13-4-18-15(19-5-13)21-6-12-7-23-10-16(12,9-21)8-20-14(22)3-11-1-2-11/h4-5,11-12H,1-3,6-10H2,(H,20,22)/t12-,16+/m1/s1 |
| InChIKey | KNYPEZXLAPKIKW-WBMJQRKESA-N |
| XLogP | 0.98 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |