C17H21N3O3S — CID 97420717
N-[[(3aR,6aR)-5-[(5-methylfuran-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 97420717) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-[[(3aR,6aR)-5-[(5-methylfuran-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[[(3aR,6aR)-5-[(5-methylfuran-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 97420717 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[[(3aR,6aR)-5-[(5-methylfuran-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(CN2C[C@@H]3COC[C@]3(CNC(=O)c3cscn3)C2)o1 |
| InChI | InChI=1S/C17H21N3O3S/c1-12-2-3-14(23-12)5-20-4-13-6-22-10-17(13,9-20)8-18-16(21)15-7-24-11-19-15/h2-3,7,11,13H,4-6,8-10H2,1H3,(H,18,21)/t13-,17+/m1/s1 |
| InChIKey | UCAGLLDMFCYQIN-DYVFJYSZSA-N |
| XLogP | 1.92 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |