C14H22N2O2S — CID 97420887
(3aS,6aR)-3a-(ethoxymethyl)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole (PubChem CID 97420887) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is (3aS,6aR)-3a-(ethoxymethyl)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-3a-(ethoxymethyl)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 97420887 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (3aS,6aR)-3a-(ethoxymethyl)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
| SMILES | CCOC[C@]12COC[C@H]1CN(Cc1csc(C)n1)C2 |
| InChI | InChI=1S/C14H22N2O2S/c1-3-17-9-14-8-16(4-12(14)6-18-10-14)5-13-7-19-11(2)15-13/h7,12H,3-6,8-10H2,1-2H3/t12-,14-/m1/s1 |
| InChIKey | UOQBYVZOXZLQDI-TZMCWYRMSA-N |
| XLogP | 1.94 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |