C17H26N2O3S — CID 97420991
(3aS,6aR)-3a-(oxan-4-ylmethoxymethyl)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole (PubChem CID 97420991) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is (3aS,6aR)-3a-(oxan-4-ylmethoxymethyl)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-3a-(oxan-4-ylmethoxymethyl)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 97420991 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (3aS,6aR)-3a-(oxan-4-ylmethoxymethyl)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
| SMILES | c1csc(CN2C[C@@H]3COC[C@]3(COCC3CCOCC3)C2)n1 |
| InChI | InChI=1S/C17H26N2O3S/c1-4-20-5-2-14(1)9-21-12-17-11-19(7-15(17)10-22-13-17)8-16-18-3-6-23-16/h3,6,14-15H,1-2,4-5,7-13H2/t15-,17-/m1/s1 |
| InChIKey | NKHGYZPZRQDLRX-NVXWUHKLSA-N |
| XLogP | 2.03 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |