C18H26N2O — CID 97421407
(3aS,6aS)-3a-(cyclopropylmethoxymethyl)-2-(pyridin-2-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole (PubChem CID 97421407) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is (3aS,6aS)-3a-(cyclopropylmethoxymethyl)-2-(pyridin-2-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole.
| Compound Name | (3aS,6aS)-3a-(cyclopropylmethoxymethyl)-2-(pyridin-2-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 97421407 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (3aS,6aS)-3a-(cyclopropylmethoxymethyl)-2-(pyridin-2-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole |
| SMILES | c1ccc(CN2C[C@H]3CCC[C@@]3(COCC3CC3)C2)nc1 |
| InChI | InChI=1S/C18H26N2O/c1-2-9-19-17(5-1)11-20-10-16-4-3-8-18(16,13-20)14-21-12-15-6-7-15/h1-2,5,9,15-16H,3-4,6-8,10-14H2/t16-,18+/m1/s1 |
| InChIKey | UYNBIOWVHNSPRC-AEFFLSMTSA-N |
| XLogP | 3.11 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |