C19H29N3O3 — CID 97421445
2-[[(3aS,6aS)-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-1-pyrrolidin-1-ylethanone (PubChem CID 97421445) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[[(3aS,6aS)-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[[(3aS,6aS)-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 97421445 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 2-[[(3aS,6aS)-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-1-pyrrolidin-1-ylethanone |
| SMILES | Cc1cc(CN2C[C@H]3CCC[C@@]3(COCC(=O)N3CCCC3)C2)no1 |
| InChI | InChI=1S/C19H29N3O3/c1-15-9-17(20-25-15)11-21-10-16-5-4-6-19(16,13-21)14-24-12-18(23)22-7-2-3-8-22/h9,16H,2-8,10-14H2,1H3/t16-,19+/m1/s1 |
| InChIKey | ZUCPNIWWAPQKMC-APWZRJJASA-N |
| XLogP | 2.22 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |