C18H21N3O2S — CID 97421559
[(3aS,6aS)-3a-(pyridin-2-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 97421559) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is [(3aS,6aS)-3a-(pyridin-2-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [(3aS,6aS)-3a-(pyridin-2-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 97421559 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [(3aS,6aS)-3a-(pyridin-2-ylmethoxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1C[C@H]2CCC[C@@]2(COCc2ccccn2)C1 |
| InChI | InChI=1S/C18H21N3O2S/c22-17(16-10-24-13-20-16)21-8-14-4-3-6-18(14,11-21)12-23-9-15-5-1-2-7-19-15/h1-2,5,7,10,13-14H,3-4,6,8-9,11-12H2/t14-,18+/m1/s1 |
| InChIKey | VNGJPAYNMAJTNH-KDOFPFPSSA-N |
| XLogP | 3.00 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |