C17H27N3O2 — CID 97421646
(4S,4aS,7aS)-4-methoxy-6-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine (PubChem CID 97421646) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is (4S,4aS,7aS)-4-methoxy-6-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine.
| Compound Name | (4S,4aS,7aS)-4-methoxy-6-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 97421646 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (4S,4aS,7aS)-4-methoxy-6-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
| SMILES | COCCN1C[C@@H]2[C@@H](OC)CCN(Cc3ccncc3)[C@@H]2C1 |
| InChI | InChI=1S/C17H27N3O2/c1-21-10-9-19-12-15-16(13-19)20(8-5-17(15)22-2)11-14-3-6-18-7-4-14/h3-4,6-7,15-17H,5,8-13H2,1-2H3/t15-,16+,17-/m0/s1 |
| InChIKey | CXVTUZHTHGLMAV-BBWFWOEESA-N |
| XLogP | 1.25 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |