C19H27N5O — CID 97421684
(4S,4aS,7aS)-4-methoxy-1-[(1-methylpyrazol-4-yl)methyl]-6-(pyridin-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine (PubChem CID 97421684) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is (4S,4aS,7aS)-4-methoxy-1-[(1-methylpyrazol-4-yl)methyl]-6-(pyridin-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine.
| Compound Name | (4S,4aS,7aS)-4-methoxy-1-[(1-methylpyrazol-4-yl)methyl]-6-(pyridin-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 97421684 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | (4S,4aS,7aS)-4-methoxy-1-[(1-methylpyrazol-4-yl)methyl]-6-(pyridin-3-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
| SMILES | CO[C@H]1CCN(Cc2cnn(C)c2)[C@@H]2CN(Cc3cccnc3)C[C@H]12 |
| InChI | InChI=1S/C19H27N5O/c1-22-10-16(9-21-22)12-24-7-5-19(25-2)17-13-23(14-18(17)24)11-15-4-3-6-20-8-15/h3-4,6,8-10,17-19H,5,7,11-14H2,1-2H3/t17-,18+,19-/m0/s1 |
| InChIKey | IGLXPIPNUNXQAD-OTWHNJEPSA-N |
| XLogP | 1.54 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |