C12H17N3O4S — CID 97422279
(3aR,6aR)-5-cyclopropylsulfonyl-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole (PubChem CID 97422279) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is (3aR,6aR)-5-cyclopropylsulfonyl-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole.
| Compound Name | (3aR,6aR)-5-cyclopropylsulfonyl-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 97422279 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (3aR,6aR)-5-cyclopropylsulfonyl-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole |
| SMILES | Cc1noc([C@]23COC[C@H]2CN(S(=O)(=O)C2CC2)C3)n1 |
| InChI | InChI=1S/C12H17N3O4S/c1-8-13-11(19-14-8)12-6-15(4-9(12)5-18-7-12)20(16,17)10-2-3-10/h9-10H,2-7H2,1H3/t9-,12-/m1/s1 |
| InChIKey | TYSSJYWIIOWJKG-BXKDBHETSA-N |
| XLogP | 0.07 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |