C16H20F2N2O2S — CID 97422365
(3aR,6aR)-N-(3,3-difluorocyclobutyl)-5-(thiophen-3-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 97422365) has the molecular formula C16H20F2N2O2S and a molecular weight of 342.41 g/mol. Its IUPAC name is (3aR,6aR)-N-(3,3-difluorocyclobutyl)-5-(thiophen-3-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-N-(3,3-difluorocyclobutyl)-5-(thiophen-3-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 97422365 |
| Molecular Formula | C16H20F2N2O2S |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (3aR,6aR)-N-(3,3-difluorocyclobutyl)-5-(thiophen-3-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | O=C(NC1CC(F)(F)C1)[C@]12COC[C@H]1CN(Cc1ccsc1)C2 |
| InChI | InChI=1S/C16H20F2N2O2S/c17-16(18)3-13(4-16)19-14(21)15-9-20(5-11-1-2-23-8-11)6-12(15)7-22-10-15/h1-2,8,12-13H,3-7,9-10H2,(H,19,21)/t12-,15-/m1/s1 |
| InChIKey | CNGOHEWGOAQLHH-IUODEOHRSA-N |
| XLogP | 2.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |