C16H21F2N3O3 — CID 97422370
(3aR,6aR)-N-(3,3-difluorocyclobutyl)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 97422370) has the molecular formula C16H21F2N3O3 and a molecular weight of 341.36 g/mol. Its IUPAC name is (3aR,6aR)-N-(3,3-difluorocyclobutyl)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-N-(3,3-difluorocyclobutyl)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 97422370 |
| Molecular Formula | C16H21F2N3O3 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (3aR,6aR)-N-(3,3-difluorocyclobutyl)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | Cc1cc(CN2C[C@@H]3COC[C@]3(C(=O)NC3CC(F)(F)C3)C2)no1 |
| InChI | InChI=1S/C16H21F2N3O3/c1-10-2-12(20-24-10)6-21-5-11-7-23-9-15(11,8-21)14(22)19-13-3-16(17,18)4-13/h2,11,13H,3-9H2,1H3,(H,19,22)/t11-,15-/m1/s1 |
| InChIKey | UAEXEQFFXYBFCC-IAQYHMDHSA-N |
| XLogP | 1.35 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |