C19H27FN2O3 — CID 97422670
(3aS,7aR)-3a-[(3-fluoro-2-pyridinyl)oxymethyl]-5-(oxan-4-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine (PubChem CID 97422670) has the molecular formula C19H27FN2O3 and a molecular weight of 350.43 g/mol. Its IUPAC name is (3aS,7aR)-3a-[(3-fluoro-2-pyridinyl)oxymethyl]-5-(oxan-4-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine.
| Compound Name | (3aS,7aR)-3a-[(3-fluoro-2-pyridinyl)oxymethyl]-5-(oxan-4-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 97422670 |
| Molecular Formula | C19H27FN2O3 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (3aS,7aR)-3a-[(3-fluoro-2-pyridinyl)oxymethyl]-5-(oxan-4-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine |
| SMILES | Fc1cccnc1OC[C@@]12CCO[C@@H]1CCN(CC1CCOCC1)C2 |
| InChI | InChI=1S/C19H27FN2O3/c20-16-2-1-7-21-18(16)25-14-19-6-11-24-17(19)3-8-22(13-19)12-15-4-9-23-10-5-15/h1-2,7,15,17H,3-6,8-14H2/t17-,19+/m1/s1 |
| InChIKey | IFZVPUBAERRWPY-MJGOQNOKSA-N |
| XLogP | 2.51 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |