C17H23FN2O4 — CID 97422674
1-[(3aS,7aR)-3a-[(3-fluoro-2-pyridinyl)oxymethyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-ethoxyethanone (PubChem CID 97422674) has the molecular formula C17H23FN2O4 and a molecular weight of 338.38 g/mol. Its IUPAC name is 1-[(3aS,7aR)-3a-[(3-fluoro-2-pyridinyl)oxymethyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-ethoxyethanone.
| Compound Name | 1-[(3aS,7aR)-3a-[(3-fluoro-2-pyridinyl)oxymethyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-ethoxyethanone |
|---|---|
| PubChem CID | 97422674 |
| Molecular Formula | C17H23FN2O4 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[(3aS,7aR)-3a-[(3-fluoro-2-pyridinyl)oxymethyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-ethoxyethanone |
| SMILES | CCOCC(=O)N1CC[C@H]2OCC[C@@]2(COc2ncccc2F)C1 |
| InChI | InChI=1S/C17H23FN2O4/c1-2-22-10-15(21)20-8-5-14-17(11-20,6-9-23-14)12-24-16-13(18)4-3-7-19-16/h3-4,7,14H,2,5-6,8-12H2,1H3/t14-,17+/m1/s1 |
| InChIKey | SBFSMSLQWVTYCK-PBHICJAKSA-N |
| XLogP | 1.64 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |