C14H17N5S — CID 97422880
2-[[(3aS,6aR)-5-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3-thiazole (PubChem CID 97422880) has the molecular formula C14H17N5S and a molecular weight of 287.39 g/mol. Its IUPAC name is 2-[[(3aS,6aR)-5-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[(3aS,6aR)-5-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 97422880 |
| Molecular Formula | C14H17N5S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-[[(3aS,6aR)-5-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3-thiazole |
| SMILES | c1cnc(N2C[C@H]3CN(Cc4nccs4)C[C@H]3C2)nc1 |
| InChI | InChI=1S/C14H17N5S/c1-2-16-14(17-3-1)19-8-11-6-18(7-12(11)9-19)10-13-15-4-5-20-13/h1-5,11-12H,6-10H2/t11-,12+ |
| InChIKey | LXWQKQJTXNFQOM-TXEJJXNPSA-N |
| XLogP | 1.50 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |