C16H22N4O2 — CID 97423108
[(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-pyrimidin-2-ylmethanone (PubChem CID 97423108) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-pyrimidin-2-ylmethanone.
| Compound Name | [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-pyrimidin-2-ylmethanone |
|---|---|
| PubChem CID | 97423108 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | [(5aS,8aS)-4-(cyclopropylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-pyrimidin-2-ylmethanone |
| SMILES | O=C(c1ncccn1)N1C[C@@H]2CN(CC3CC3)CCO[C@@H]2C1 |
| InChI | InChI=1S/C16H22N4O2/c21-16(15-17-4-1-5-18-15)20-10-13-9-19(8-12-2-3-12)6-7-22-14(13)11-20/h1,4-5,12-14H,2-3,6-11H2/t13-,14+/m0/s1 |
| InChIKey | SZQQUFOMJPSVBR-UONOGXRCSA-N |
| XLogP | 0.66 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |