C18H23FN2O3 — CID 97423377
1-[(3aS,7aR)-3a-[(3-fluoro-2-pyridinyl)oxymethyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-cyclopropylethanone (PubChem CID 97423377) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is 1-[(3aS,7aR)-3a-[(3-fluoro-2-pyridinyl)oxymethyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-cyclopropylethanone.
| Compound Name | 1-[(3aS,7aR)-3a-[(3-fluoro-2-pyridinyl)oxymethyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-cyclopropylethanone |
|---|---|
| PubChem CID | 97423377 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1-[(3aS,7aR)-3a-[(3-fluoro-2-pyridinyl)oxymethyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-cyclopropylethanone |
| SMILES | O=C(CC1CC1)N1CC[C@H]2OCC[C@@]2(COc2ncccc2F)C1 |
| InChI | InChI=1S/C18H23FN2O3/c19-14-2-1-7-20-17(14)24-12-18-6-9-23-15(18)5-8-21(11-18)16(22)10-13-3-4-13/h1-2,7,13,15H,3-6,8-12H2/t15-,18+/m1/s1 |
| InChIKey | HCNGFNRMZBARKT-QAPCUYQASA-N |
| XLogP | 2.41 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |