C26H25N3O3 — CID 97423626
[2-(1H-indol-3-yl)-2-oxoethyl] (Z)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoate (PubChem CID 97423626) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] (Z)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] (Z)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 97423626 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] (Z)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1ccc(Cn2nc(C)c(/C=C\C(=O)OCC(=O)c3c[nH]c4ccccc34)c2C)cc1 |
| InChI | InChI=1S/C26H25N3O3/c1-17-8-10-20(11-9-17)15-29-19(3)21(18(2)28-29)12-13-26(31)32-16-25(30)23-14-27-24-7-5-4-6-22(23)24/h4-14,27H,15-16H2,1-3H3/b13-12- |
| InChIKey | WTRHMMAHUQAPMC-SEYXRHQNSA-N |
| XLogP | 4.78 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|