C17H17Cl2N3O2S2 — CID 97425766
(4S)-4-(2,4-dichlorophenyl)-1-(thian-4-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione (PubChem CID 97425766) has the molecular formula C17H17Cl2N3O2S2 and a molecular weight of 430.38 g/mol. Its IUPAC name is (4S)-4-(2,4-dichlorophenyl)-1-(thian-4-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione.
| Compound Name | (4S)-4-(2,4-dichlorophenyl)-1-(thian-4-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
|---|---|
| PubChem CID | 97425766 |
| Molecular Formula | C17H17Cl2N3O2S2 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | (4S)-4-(2,4-dichlorophenyl)-1-(thian-4-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
| SMILES | O=C1CS[C@H](c2ccc(Cl)cc2Cl)c2c(n(C3CCSCC3)[nH]c2=O)N1 |
| InChI | InChI=1S/C17H17Cl2N3O2S2/c18-9-1-2-11(12(19)7-9)15-14-16(20-13(23)8-26-15)22(21-17(14)24)10-3-5-25-6-4-10/h1-2,7,10,15H,3-6,8H2,(H,20,23)(H,21,24)/t15-/m1/s1 |
| InChIKey | ZRSDVGJTSQXKMW-OAHLLOKOSA-N |
| XLogP | 4.33 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |