C14H13ClFN3O2 — CID 97428040
2-chloro-6-fluoro-N-[1-[(3S)-oxolan-3-yl]pyrazol-4-yl]benzamide (PubChem CID 97428040) has the molecular formula C14H13ClFN3O2 and a molecular weight of 309.73 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[1-[(3S)-oxolan-3-yl]pyrazol-4-yl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[1-[(3S)-oxolan-3-yl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 97428040 |
| Molecular Formula | C14H13ClFN3O2 |
| Molecular Weight | 309.73 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-chloro-6-fluoro-N-[1-[(3S)-oxolan-3-yl]pyrazol-4-yl]benzamide |
| SMILES | O=C(Nc1cnn([C@H]2CCOC2)c1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C14H13ClFN3O2/c15-11-2-1-3-12(16)13(11)14(20)18-9-6-17-19(7-9)10-4-5-21-8-10/h1-3,6-7,10H,4-5,8H2,(H,18,20)/t10-/m0/s1 |
| InChIKey | UVXFNVFRKOEAEW-JTQLQIEISA-N |
| XLogP | 2.89 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.73 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |