C14H16FN3O4S — CID 97428268
3-fluoro-4-methoxy-N-[1-[(3S)-oxolan-3-yl]pyrazol-4-yl]benzenesulfonamide (PubChem CID 97428268) has the molecular formula C14H16FN3O4S and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-[1-[(3S)-oxolan-3-yl]pyrazol-4-yl]benzenesulfonamide.
| Compound Name | 3-fluoro-4-methoxy-N-[1-[(3S)-oxolan-3-yl]pyrazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 97428268 |
| Molecular Formula | C14H16FN3O4S |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 3-fluoro-4-methoxy-N-[1-[(3S)-oxolan-3-yl]pyrazol-4-yl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cnn([C@H]3CCOC3)c2)cc1F |
| InChI | InChI=1S/C14H16FN3O4S/c1-21-14-3-2-12(6-13(14)15)23(19,20)17-10-7-16-18(8-10)11-4-5-22-9-11/h2-3,6-8,11,17H,4-5,9H2,1H3/t11-/m0/s1 |
| InChIKey | MEJHMYZTUFNMKU-NSHDSACASA-N |
| XLogP | 1.79 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |