C20H16F3N3O3 — CID 97434189
3-[3-[(3R)-oxolan-3-yl]-5-[(2,3,6-trifluorophenyl)methyl]-1,2,4-triazol-1-yl]benzoic acid (PubChem CID 97434189) has the molecular formula C20H16F3N3O3 and a molecular weight of 403.36 g/mol. Its IUPAC name is 3-[3-[(3R)-oxolan-3-yl]-5-[(2,3,6-trifluorophenyl)methyl]-1,2,4-triazol-1-yl]benzoic acid.
| Compound Name | 3-[3-[(3R)-oxolan-3-yl]-5-[(2,3,6-trifluorophenyl)methyl]-1,2,4-triazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 97434189 |
| Molecular Formula | C20H16F3N3O3 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3-[3-[(3R)-oxolan-3-yl]-5-[(2,3,6-trifluorophenyl)methyl]-1,2,4-triazol-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-n2nc([C@H]3CCOC3)nc2Cc2c(F)ccc(F)c2F)c1 |
| InChI | InChI=1S/C20H16F3N3O3/c21-15-4-5-16(22)18(23)14(15)9-17-24-19(12-6-7-29-10-12)25-26(17)13-3-1-2-11(8-13)20(27)28/h1-5,8,12H,6-7,9-10H2,(H,27,28)/t12-/m0/s1 |
| InChIKey | SBVKQENIIKVZKG-LBPRGKRZSA-N |
| XLogP | 3.48 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|