C15H22N2O4S2 — CID 97434697
5-acetyl-N-[2-[(2R)-1-methylsulfonylpiperidin-2-yl]ethyl]thiophene-3-carboxamide (PubChem CID 97434697) has the molecular formula C15H22N2O4S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 5-acetyl-N-[2-[(2R)-1-methylsulfonylpiperidin-2-yl]ethyl]thiophene-3-carboxamide.
| Compound Name | 5-acetyl-N-[2-[(2R)-1-methylsulfonylpiperidin-2-yl]ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 97434697 |
| Molecular Formula | C15H22N2O4S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 5-acetyl-N-[2-[(2R)-1-methylsulfonylpiperidin-2-yl]ethyl]thiophene-3-carboxamide |
| SMILES | CC(=O)c1cc(C(=O)NCC[C@H]2CCCCN2S(C)(=O)=O)cs1 |
| InChI | InChI=1S/C15H22N2O4S2/c1-11(18)14-9-12(10-22-14)15(19)16-7-6-13-5-3-4-8-17(13)23(2,20)21/h9-10,13H,3-8H2,1-2H3,(H,16,19)/t13-/m1/s1 |
| InChIKey | JRZIGHWEEDIVSE-CYBMUJFWSA-N |
| XLogP | 1.88 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |