C16H23N7OS — CID 97434923
1-[2-[[(1S)-cyclohex-3-en-1-yl]methyl]pyrazol-3-yl]-3-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]urea (PubChem CID 97434923) has the molecular formula C16H23N7OS and a molecular weight of 361.48 g/mol. Its IUPAC name is 1-[2-[[(1S)-cyclohex-3-en-1-yl]methyl]pyrazol-3-yl]-3-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]urea.
| Compound Name | 1-[2-[[(1S)-cyclohex-3-en-1-yl]methyl]pyrazol-3-yl]-3-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]urea |
|---|---|
| PubChem CID | 97434923 |
| Molecular Formula | C16H23N7OS |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 1-[2-[[(1S)-cyclohex-3-en-1-yl]methyl]pyrazol-3-yl]-3-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]urea |
| SMILES | Cc1nc(SCCNC(=O)Nc2ccnn2C[C@@H]2CC=CCC2)n[nH]1 |
| InChI | InChI=1S/C16H23N7OS/c1-12-19-16(22-21-12)25-10-9-17-15(24)20-14-7-8-18-23(14)11-13-5-3-2-4-6-13/h2-3,7-8,13H,4-6,9-11H2,1H3,(H2,17,20,24)(H,19,21,22)/t13-/m1/s1 |
| InChIKey | FGSIBPMARKLEDQ-CYBMUJFWSA-N |
| XLogP | 2.58 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|