C17H25NO4S — CID 97435359
(2R)-N-[3-(cyclohexyloxymethyl)phenyl]-2-methylsulfonylpropanamide (PubChem CID 97435359) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is (2R)-N-[3-(cyclohexyloxymethyl)phenyl]-2-methylsulfonylpropanamide.
| Compound Name | (2R)-N-[3-(cyclohexyloxymethyl)phenyl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 97435359 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (2R)-N-[3-(cyclohexyloxymethyl)phenyl]-2-methylsulfonylpropanamide |
| SMILES | C[C@H](C(=O)Nc1cccc(COC2CCCCC2)c1)S(C)(=O)=O |
| InChI | InChI=1S/C17H25NO4S/c1-13(23(2,20)21)17(19)18-15-8-6-7-14(11-15)12-22-16-9-4-3-5-10-16/h6-8,11,13,16H,3-5,9-10,12H2,1-2H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | FLEMCTFBLPRXQS-CYBMUJFWSA-N |
| XLogP | 2.91 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |