C21H25N5O2 — CID 97435699
(2R)-4-(4-methoxyphenyl)-2-methyl-N-(1-methylindazol-5-yl)piperazine-1-carboxamide (PubChem CID 97435699) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2R)-4-(4-methoxyphenyl)-2-methyl-N-(1-methylindazol-5-yl)piperazine-1-carboxamide.
| Compound Name | (2R)-4-(4-methoxyphenyl)-2-methyl-N-(1-methylindazol-5-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 97435699 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (2R)-4-(4-methoxyphenyl)-2-methyl-N-(1-methylindazol-5-yl)piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)Nc3ccc4c(cnn4C)c3)[C@H](C)C2)cc1 |
| InChI | InChI=1S/C21H25N5O2/c1-15-14-25(18-5-7-19(28-3)8-6-18)10-11-26(15)21(27)23-17-4-9-20-16(12-17)13-22-24(20)2/h4-9,12-13,15H,10-11,14H2,1-3H3,(H,23,27)/t15-/m1/s1 |
| InChIKey | ZMKVVDGAOPZRRC-OAHLLOKOSA-N |
| XLogP | 3.32 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|