C18H28N4O3 — CID 97435997
3-[[[(3R)-1-(2-methoxyethyl)piperidin-3-yl]methyl-methylcarbamoyl]amino]benzamide (PubChem CID 97435997) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-[[[(3R)-1-(2-methoxyethyl)piperidin-3-yl]methyl-methylcarbamoyl]amino]benzamide.
| Compound Name | 3-[[[(3R)-1-(2-methoxyethyl)piperidin-3-yl]methyl-methylcarbamoyl]amino]benzamide |
|---|---|
| PubChem CID | 97435997 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 3-[[[(3R)-1-(2-methoxyethyl)piperidin-3-yl]methyl-methylcarbamoyl]amino]benzamide |
| SMILES | COCCN1CCC[C@@H](CN(C)C(=O)Nc2cccc(C(N)=O)c2)C1 |
| InChI | InChI=1S/C18H28N4O3/c1-21(12-14-5-4-8-22(13-14)9-10-25-2)18(24)20-16-7-3-6-15(11-16)17(19)23/h3,6-7,11,14H,4-5,8-10,12-13H2,1-2H3,(H2,19,23)(H,20,24)/t14-/m0/s1 |
| InChIKey | YATAUODDQRJIOH-AWEZNQCLSA-N |
| XLogP | 1.61 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |