C14H12N4O2 — CID 97436994
3-[(3R)-oxolan-3-yl]-5-quinoxalin-6-yl-1,2,4-oxadiazole (PubChem CID 97436994) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 3-[(3R)-oxolan-3-yl]-5-quinoxalin-6-yl-1,2,4-oxadiazole.
| Compound Name | 3-[(3R)-oxolan-3-yl]-5-quinoxalin-6-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 97436994 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-[(3R)-oxolan-3-yl]-5-quinoxalin-6-yl-1,2,4-oxadiazole |
| SMILES | c1cnc2cc(-c3nc([C@H]4CCOC4)no3)ccc2n1 |
| InChI | InChI=1S/C14H12N4O2/c1-2-11-12(16-5-4-15-11)7-9(1)14-17-13(18-20-14)10-3-6-19-8-10/h1-2,4-5,7,10H,3,6,8H2/t10-/m0/s1 |
| InChIKey | VVFPFWKUBNTOOF-JTQLQIEISA-N |
| XLogP | 2.18 |
| TPSA | 73.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |