C16H17N3O2 — CID 97437031
5-(1,3-dimethylindol-2-yl)-3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazole (PubChem CID 97437031) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 5-(1,3-dimethylindol-2-yl)-3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazole.
| Compound Name | 5-(1,3-dimethylindol-2-yl)-3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 97437031 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 5-(1,3-dimethylindol-2-yl)-3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazole |
| SMILES | Cc1c(-c2nc([C@@H]3CCOC3)no2)n(C)c2ccccc12 |
| InChI | InChI=1S/C16H17N3O2/c1-10-12-5-3-4-6-13(12)19(2)14(10)16-17-15(18-21-16)11-7-8-20-9-11/h3-6,11H,7-9H2,1-2H3/t11-/m1/s1 |
| InChIKey | KJUQYFHXPVKAMU-LLVKDONJSA-N |
| XLogP | 3.04 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|