C20H23FN2O3 — CID 97437885
1-[2-(2-fluorophenoxy)phenyl]-3-[3-[(3R)-oxolan-3-yl]propyl]urea (PubChem CID 97437885) has the molecular formula C20H23FN2O3 and a molecular weight of 358.41 g/mol. Its IUPAC name is 1-[2-(2-fluorophenoxy)phenyl]-3-[3-[(3R)-oxolan-3-yl]propyl]urea.
| Compound Name | 1-[2-(2-fluorophenoxy)phenyl]-3-[3-[(3R)-oxolan-3-yl]propyl]urea |
|---|---|
| PubChem CID | 97437885 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-[2-(2-fluorophenoxy)phenyl]-3-[3-[(3R)-oxolan-3-yl]propyl]urea |
| SMILES | O=C(NCCC[C@@H]1CCOC1)Nc1ccccc1Oc1ccccc1F |
| InChI | InChI=1S/C20H23FN2O3/c21-16-7-1-3-9-18(16)26-19-10-4-2-8-17(19)23-20(24)22-12-5-6-15-11-13-25-14-15/h1-4,7-10,15H,5-6,11-14H2,(H2,22,23,24)/t15-/m1/s1 |
| InChIKey | PFOOMCCROMFSGN-OAHLLOKOSA-N |
| XLogP | 4.56 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|