C22H26N2O3 — CID 97439490
(2'S,3S)-2-benzyl-N-(2-methoxyethyl)spiro[1H-isoindole-3,4'-oxolane]-2'-carboxamide (PubChem CID 97439490) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is (2'S,3S)-2-benzyl-N-(2-methoxyethyl)spiro[1H-isoindole-3,4'-oxolane]-2'-carboxamide.
| Compound Name | (2'S,3S)-2-benzyl-N-(2-methoxyethyl)spiro[1H-isoindole-3,4'-oxolane]-2'-carboxamide |
|---|---|
| PubChem CID | 97439490 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (2'S,3S)-2-benzyl-N-(2-methoxyethyl)spiro[1H-isoindole-3,4'-oxolane]-2'-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1C[C@@]2(CO1)c1ccccc1CN2Cc1ccccc1 |
| InChI | InChI=1S/C22H26N2O3/c1-26-12-11-23-21(25)20-13-22(16-27-20)19-10-6-5-9-18(19)15-24(22)14-17-7-3-2-4-8-17/h2-10,20H,11-16H2,1H3,(H,23,25)/t20-,22+/m0/s1 |
| InChIKey | CWYFGOKHCONNLC-RBBKRZOGSA-N |
| XLogP | 2.45 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|