C23H31N5O4 — CID 97440291
(6R)-1-N'-(3-methoxyphenyl)-6-N-(2-methylpropyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-1',6-dicarboxamide (PubChem CID 97440291) has the molecular formula C23H31N5O4 and a molecular weight of 441.53 g/mol. Its IUPAC name is (6R)-1-N'-(3-methoxyphenyl)-6-N-(2-methylpropyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-1',6-dicarboxamide.
| Compound Name | (6R)-1-N'-(3-methoxyphenyl)-6-N-(2-methylpropyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-1',6-dicarboxamide |
|---|---|
| PubChem CID | 97440291 |
| Molecular Formula | C23H31N5O4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | (6R)-1-N'-(3-methoxyphenyl)-6-N-(2-methylpropyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-1',6-dicarboxamide |
| SMILES | COc1cccc(NC(=O)N2CCC3(CC2)O[C@@H](C(=O)NCC(C)C)Cn2ccnc23)c1 |
| InChI | InChI=1S/C23H31N5O4/c1-16(2)14-25-20(29)19-15-28-12-9-24-21(28)23(32-19)7-10-27(11-8-23)22(30)26-17-5-4-6-18(13-17)31-3/h4-6,9,12-13,16,19H,7-8,10-11,14-15H2,1-3H3,(H,25,29)(H,26,30)/t19-/m1/s1 |
| InChIKey | PSUPELYXTHNYSF-LJQANCHMSA-N |
| XLogP | 2.59 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |