C18H21N3O5S — CID 97440615
(1,1-dioxospiro[3,5-dihydro-2H-6,1λ6,2-benzoxathiazocine-4,4'-piperidine]-1'-yl)-(5-methyl-1,2-oxazol-3-yl)methanone (PubChem CID 97440615) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is (1,1-dioxospiro[3,5-dihydro-2H-6,1λ6,2-benzoxathiazocine-4,4'-piperidine]-1'-yl)-(5-methyl-1,2-oxazol-3-yl)methanone.
| Compound Name | (1,1-dioxospiro[3,5-dihydro-2H-6,1λ6,2-benzoxathiazocine-4,4'-piperidine]-1'-yl)-(5-methyl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 97440615 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (1,1-dioxospiro[3,5-dihydro-2H-6,1λ6,2-benzoxathiazocine-4,4'-piperidine]-1'-yl)-(5-methyl-1,2-oxazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCC3(CC2)CNS(=O)(=O)c2ccccc2OC3)no1 |
| InChI | InChI=1S/C18H21N3O5S/c1-13-10-14(20-26-13)17(22)21-8-6-18(7-9-21)11-19-27(23,24)16-5-3-2-4-15(16)25-12-18/h2-5,10,19H,6-9,11-12H2,1H3 |
| InChIKey | WAEUIANDTDWKLC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |