C12H17FN4O2S — CID 97441109
(3aR,8aR)-6-(5-fluoropyrimidin-2-yl)-2-methyl-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide (PubChem CID 97441109) has the molecular formula C12H17FN4O2S and a molecular weight of 300.36 g/mol. Its IUPAC name is (3aR,8aR)-6-(5-fluoropyrimidin-2-yl)-2-methyl-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide.
| Compound Name | (3aR,8aR)-6-(5-fluoropyrimidin-2-yl)-2-methyl-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide |
|---|---|
| PubChem CID | 97441109 |
| Molecular Formula | C12H17FN4O2S |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (3aR,8aR)-6-(5-fluoropyrimidin-2-yl)-2-methyl-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide |
| SMILES | CN1C[C@H]2CCN(c3ncc(F)cn3)CC[C@H]2S1(=O)=O |
| InChI | InChI=1S/C12H17FN4O2S/c1-16-8-9-2-4-17(5-3-11(9)20(16,18)19)12-14-6-10(13)7-15-12/h6-7,9,11H,2-5,8H2,1H3/t9-,11-/m1/s1 |
| InChIKey | KEDAMBBCGFVYTN-MWLCHTKSSA-N |
| XLogP | 0.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |